C20H17ClN4O5S — CID 91516685
[7-chloro-2-[1-(6-methyl-2-pyridinyl)ethyl]-1,10-dioxo-5H-pyridazino[4,5-b]quinolin-4-yl] methanesulfonate (PubChem CID 91516685) has the molecular formula C20H17ClN4O5S and a molecular weight of 460.90 g/mol. Its IUPAC name is [7-chloro-2-[1-(6-methyl-2-pyridinyl)ethyl]-1,10-dioxo-5H-pyridazino[4,5-b]quinolin-4-yl] methanesulfonate.
| Compound Name | [7-chloro-2-[1-(6-methyl-2-pyridinyl)ethyl]-1,10-dioxo-5H-pyridazino[4,5-b]quinolin-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 91516685 |
| Molecular Formula | C20H17ClN4O5S |
| Molecular Weight | 460.90 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | [7-chloro-2-[1-(6-methyl-2-pyridinyl)ethyl]-1,10-dioxo-5H-pyridazino[4,5-b]quinolin-4-yl] methanesulfonate |
| SMILES | Cc1cccc(C(C)n2nc(OS(C)(=O)=O)c3[nH]c4cc(Cl)ccc4c(=O)c3c2=O)n1 |
| InChI | InChI=1S/C20H17ClN4O5S/c1-10-5-4-6-14(22-10)11(2)25-20(27)16-17(19(24-25)30-31(3,28)29)23-15-9-12(21)7-8-13(15)18(16)26/h4-9,11H,1-3H3,(H,23,26) |
| InChIKey | NZZSTGSJAUDEPY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.90 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|