C21H28N2O4 — CID 101171948
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-diazo-4-[dideuterio(phenyl)methoxy]-3-oxobutanoate (PubChem CID 101171948) has the molecular formula C21H28N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-diazo-4-[dideuterio(phenyl)methoxy]-3-oxobutanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-diazo-4-[dideuterio(phenyl)methoxy]-3-oxobutanoate |
|---|---|
| PubChem CID | 101171948 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-diazo-4-[dideuterio(phenyl)methoxy]-3-oxobutanoate |
| SMILES | [2H]C([2H])(OCC(=O)C(=[N+]=[N-])C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O4/c1-14(2)17-10-9-15(3)11-19(17)27-21(25)20(23-22)18(24)13-26-12-16-7-5-4-6-8-16/h4-8,14-15,17,19H,9-13H2,1-3H3/t15-,17+,19-/m1/s1/i12D2 |
| InChIKey | OVQMODWJRPIOEK-LYNIIPFZSA-N |
| XLogP | 3.45 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|