C20H30N2O4 — CID 101178410
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-cyclohex-2-en-1-yloxy-2-diazo-3-oxobutanoate (PubChem CID 101178410) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-cyclohex-2-en-1-yloxy-2-diazo-3-oxobutanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-cyclohex-2-en-1-yloxy-2-diazo-3-oxobutanoate |
|---|---|
| PubChem CID | 101178410 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-cyclohex-2-en-1-yloxy-2-diazo-3-oxobutanoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)C(=[N+]=[N-])C(=O)COC1C=CCCC1 |
| InChI | InChI=1S/C20H30N2O4/c1-13(2)16-10-9-14(3)11-18(16)26-20(24)19(22-21)17(23)12-25-15-7-5-4-6-8-15/h5,7,13-16,18H,4,6,8-12H2,1-3H3/t14-,15?,16+,18-/m1/s1 |
| InChIKey | DQXLFIXIZHGFAP-OJISTFMOSA-N |
| XLogP | 3.36 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|