C11H27N7 — CID 101181168
2-[2-(1,4,7,10-tetrazacyclododec-1-yl)ethyl]guanidine (PubChem CID 101181168) has the molecular formula C11H27N7 and a molecular weight of 257.39 g/mol. Its IUPAC name is 2-[2-(1,4,7,10-tetrazacyclododec-1-yl)ethyl]guanidine.
| Compound Name | 2-[2-(1,4,7,10-tetrazacyclododec-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 101181168 |
| Molecular Formula | C11H27N7 |
| Molecular Weight | 257.39 g/mol |
| Exact Mass | 257.23 |
| IUPAC Name | 2-[2-(1,4,7,10-tetrazacyclododec-1-yl)ethyl]guanidine |
| SMILES | NC(N)=NCCN1CCNCCNCCNCC1 |
| InChI | InChI=1S/C11H27N7/c12-11(13)17-7-10-18-8-5-15-3-1-14-2-4-16-6-9-18/h14-16H,1-10H2,(H4,12,13,17) |
| InChIKey | IKANVDHMORBWMW-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.39 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|