C17H20N4O6 — CID 101182581
[5-nitro-3-(phenylmethoxymethyl)imidazol-4-yl]methyl (2S)-2-acetamidopropanoate (PubChem CID 101182581) has the molecular formula C17H20N4O6 and a molecular weight of 376.37 g/mol. Its IUPAC name is [5-nitro-3-(phenylmethoxymethyl)imidazol-4-yl]methyl (2S)-2-acetamidopropanoate.
| Compound Name | [5-nitro-3-(phenylmethoxymethyl)imidazol-4-yl]methyl (2S)-2-acetamidopropanoate |
|---|---|
| PubChem CID | 101182581 |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [5-nitro-3-(phenylmethoxymethyl)imidazol-4-yl]methyl (2S)-2-acetamidopropanoate |
| SMILES | CC(=O)N[C@@H](C)C(=O)OCc1c([N+](=O)[O-])ncn1COCc1ccccc1 |
| InChI | InChI=1S/C17H20N4O6/c1-12(19-13(2)22)17(23)27-9-15-16(21(24)25)18-10-20(15)11-26-8-14-6-4-3-5-7-14/h3-7,10,12H,8-9,11H2,1-2H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | KEIKHTMMCGRQKH-LBPRGKRZSA-N |
| XLogP | 1.53 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|