C62H62N4O6 — CID 101183391
tert-butyl-[3-[(E)-2-[3-[tert-butyl(oxido)amino]phenyl]-1,2-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-oxoazanium (PubChem CID 101183391) has the molecular formula C62H62N4O6 and a molecular weight of 959.20 g/mol. Its IUPAC name is tert-butyl-[3-[(E)-2-[3-[tert-butyl(oxido)amino]phenyl]-1,2-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-oxoazanium.
| Compound Name | tert-butyl-[3-[(E)-2-[3-[tert-butyl(oxido)amino]phenyl]-1,2-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-oxoazanium |
|---|---|
| PubChem CID | 101183391 |
| Molecular Formula | C62H62N4O6 |
| Molecular Weight | 959.20 g/mol |
| Exact Mass | 958.47 |
| IUPAC Name | tert-butyl-[3-[(E)-2-[3-[tert-butyl(oxido)amino]phenyl]-1,2-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-oxoazanium |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(/C(=C(/c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)c3cccc([N+](=O)C(C)(C)C)c3)c3cccc(N([O-])C(C)(C)C)c3)cc2)cc1 |
| InChI | InChI=1S/C62H62N4O6/c1-61(2,3)65(67)53-15-11-13-45(41-53)59(43-17-21-47(22-18-43)63(49-25-33-55(69-7)34-26-49)50-27-35-56(70-8)36-28-50)60(46-14-12-16-54(42-46)66(68)62(4,5)6)44-19-23-48(24-20-44)64(51-29-37-57(71-9)38-30-51)52-31-39-58(72-10)40-32-52/h11-42H,1-10H3/b60-59+ |
| InChIKey | WMFIKQRTMWXYFB-BCLHHTJESA-N |
| XLogP | 15.98 |
| TPSA | 89.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.20 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|