C14H6F2N4 — CID 101184926
7,10-difluoropyrazino[2,3-f][1,10]phenanthroline (PubChem CID 101184926) has the molecular formula C14H6F2N4 and a molecular weight of 268.23 g/mol. Its IUPAC name is 7,10-difluoropyrazino[2,3-f][1,10]phenanthroline.
| Compound Name | 7,10-difluoropyrazino[2,3-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 101184926 |
| Molecular Formula | C14H6F2N4 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 7,10-difluoropyrazino[2,3-f][1,10]phenanthroline |
| SMILES | Fc1ccc2c3nccnc3c3ccc(F)nc3c2n1 |
| InChI | InChI=1S/C14H6F2N4/c15-9-3-1-7-11-12(18-6-5-17-11)8-2-4-10(16)20-14(8)13(7)19-9/h1-6H |
| InChIKey | HUQQCZFRJTVYIS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|