C18H28N2O3S — CID 101185311
tert-butyl (2S,3R,4S)-3-(methoxyamino)-2-methyl-4-(phenylsulfanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 101185311) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is tert-butyl (2S,3R,4S)-3-(methoxyamino)-2-methyl-4-(phenylsulfanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R,4S)-3-(methoxyamino)-2-methyl-4-(phenylsulfanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101185311 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | tert-butyl (2S,3R,4S)-3-(methoxyamino)-2-methyl-4-(phenylsulfanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CON[C@@H]1[C@@H](CSc2ccccc2)CN(C(=O)OC(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C18H28N2O3S/c1-13-16(19-22-5)14(12-24-15-9-7-6-8-10-15)11-20(13)17(21)23-18(2,3)4/h6-10,13-14,16,19H,11-12H2,1-5H3/t13-,14+,16-/m0/s1 |
| InChIKey | XYPWBJLWBYUYON-LZWOXQAQSA-N |
| XLogP | 3.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|