C22H33N6O+ — CID 101188105
1-[[4-(1,4,7,10-tetrazacyclododec-1-ylmethyl)phenyl]methyl]pyridin-1-ium-2-carboxamide (PubChem CID 101188105) has the molecular formula C22H33N6O+ and a molecular weight of 397.55 g/mol. Its IUPAC name is 1-[[4-(1,4,7,10-tetrazacyclododec-1-ylmethyl)phenyl]methyl]pyridin-1-ium-2-carboxamide.
| Compound Name | 1-[[4-(1,4,7,10-tetrazacyclododec-1-ylmethyl)phenyl]methyl]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 101188105 |
| Molecular Formula | C22H33N6O+ |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 1-[[4-(1,4,7,10-tetrazacyclododec-1-ylmethyl)phenyl]methyl]pyridin-1-ium-2-carboxamide |
| SMILES | NC(=O)c1cccc[n+]1Cc1ccc(CN2CCNCCNCCNCC2)cc1 |
| InChI | InChI=1S/C22H32N6O/c23-22(29)21-3-1-2-14-28(21)18-20-6-4-19(5-7-20)17-27-15-12-25-10-8-24-9-11-26-13-16-27/h1-7,14,24-26H,8-13,15-18H2,(H-,23,29)/p+1 |
| InChIKey | QPBLFPKMTOWQII-UHFFFAOYSA-O |
| XLogP | -0.29 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|