C9H8O3 — CID 101190042
4-hydroxy-6-methyl-5-methylidenecyclohepta-3,6-diene-1,2-dione (PubChem CID 101190042) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-5-methylidenecyclohepta-3,6-diene-1,2-dione.
| Compound Name | 4-hydroxy-6-methyl-5-methylidenecyclohepta-3,6-diene-1,2-dione |
|---|---|
| PubChem CID | 101190042 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 4-hydroxy-6-methyl-5-methylidenecyclohepta-3,6-diene-1,2-dione |
| SMILES | C=C1C(C)=CC(=O)C(=O)C=C1O |
| InChI | InChI=1S/C9H8O3/c1-5-3-8(11)9(12)4-7(10)6(5)2/h3-4,10H,2H2,1H3 |
| InChIKey | OSNBULSASRYHBD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|