C11H16O — CID 101190095
(3aE,6Z)-4-methyl-1,3,5,8,9,9a-hexahydrocycloocta[c]furan (PubChem CID 101190095) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (3aE,6Z)-4-methyl-1,3,5,8,9,9a-hexahydrocycloocta[c]furan.
| Compound Name | (3aE,6Z)-4-methyl-1,3,5,8,9,9a-hexahydrocycloocta[c]furan |
|---|---|
| PubChem CID | 101190095 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (3aE,6Z)-4-methyl-1,3,5,8,9,9a-hexahydrocycloocta[c]furan |
| SMILES | C/C1=C2\COCC2CC/C=C\C1 |
| InChI | InChI=1S/C11H16O/c1-9-5-3-2-4-6-10-7-12-8-11(9)10/h2-3,10H,4-8H2,1H3/b3-2-,11-9- |
| InChIKey | IPMAUFBRMGQDHC-AZXFPFJESA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|