C20H28N2O5 — CID 101192186
[4-(3-butoxypropylamino)-4-oxobutanoyl] 2,3-dihydroindole-1-carboxylate (PubChem CID 101192186) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is [4-(3-butoxypropylamino)-4-oxobutanoyl] 2,3-dihydroindole-1-carboxylate.
| Compound Name | [4-(3-butoxypropylamino)-4-oxobutanoyl] 2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 101192186 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | [4-(3-butoxypropylamino)-4-oxobutanoyl] 2,3-dihydroindole-1-carboxylate |
| SMILES | CCCCOCCCNC(=O)CCC(=O)OC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H28N2O5/c1-2-3-14-26-15-6-12-21-18(23)9-10-19(24)27-20(25)22-13-11-16-7-4-5-8-17(16)22/h4-5,7-8H,2-3,6,9-15H2,1H3,(H,21,23) |
| InChIKey | SMOBBYIGPHIIFT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|