C9H17NO2S — CID 101193026
(4aS,8aR)-1-methyl-3,4,4a,5,6,7,8,8a-octahydrobenzo[c]thiazine 2,2-dioxide (PubChem CID 101193026) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is (4aS,8aR)-1-methyl-3,4,4a,5,6,7,8,8a-octahydrobenzo[c]thiazine 2,2-dioxide.
| Compound Name | (4aS,8aR)-1-methyl-3,4,4a,5,6,7,8,8a-octahydrobenzo[c]thiazine 2,2-dioxide |
|---|---|
| PubChem CID | 101193026 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | (4aS,8aR)-1-methyl-3,4,4a,5,6,7,8,8a-octahydrobenzo[c]thiazine 2,2-dioxide |
| SMILES | CN1[C@@H]2CCCC[C@H]2CCS1(=O)=O |
| InChI | InChI=1S/C9H17NO2S/c1-10-9-5-3-2-4-8(9)6-7-13(10,11)12/h8-9H,2-7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | SVAIAJBEMAYYSA-DTWKUNHWSA-N |
| XLogP | 1.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |