C62H82Si2 — CID 101194214
tri(propan-2-yl)-[3,8,13,18-tetra(cyclohexylidene)-20-tri(propan-2-yl)silylicosa-1,4,6,9,11,14,16,19-octaynyl]silane (PubChem CID 101194214) has the molecular formula C62H82Si2 and a molecular weight of 883.51 g/mol. Its IUPAC name is tri(propan-2-yl)-[3,8,13,18-tetra(cyclohexylidene)-20-tri(propan-2-yl)silylicosa-1,4,6,9,11,14,16,19-octaynyl]silane.
| Compound Name | tri(propan-2-yl)-[3,8,13,18-tetra(cyclohexylidene)-20-tri(propan-2-yl)silylicosa-1,4,6,9,11,14,16,19-octaynyl]silane |
|---|---|
| PubChem CID | 101194214 |
| Molecular Formula | C62H82Si2 |
| Molecular Weight | 883.51 g/mol |
| Exact Mass | 882.60 |
| IUPAC Name | tri(propan-2-yl)-[3,8,13,18-tetra(cyclohexylidene)-20-tri(propan-2-yl)silylicosa-1,4,6,9,11,14,16,19-octaynyl]silane |
| SMILES | CC(C)[Si](C#CC(C#CC#CC(C#CC#CC(C#CC#CC(C#C[Si](C(C)C)(C(C)C)C(C)C)=C1CCCCC1)=C1CCCCC1)=C1CCCCC1)=C1CCCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C62H82Si2/c1-49(2)63(50(3)4,51(5)6)47-45-61(59-35-21-15-22-36-59)43-29-27-41-57(55-31-17-13-18-32-55)39-25-26-40-58(56-33-19-14-20-34-56)42-28-30-44-62(60-37-23-16-24-38-60)46-48-64(52(7)8,53(9)10)54(11)12/h49-54H,13-24,31-38H2,1-12H3 |
| InChIKey | ZUPPAGKOTJVINE-UHFFFAOYSA-N |
| XLogP | 16.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.51 |
| LogP ≤ 5 | 16.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|