C24H19N5O6 — CID 101196616
(2R)-3-(2,4-dioxopteridin-1-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 101196616) has the molecular formula C24H19N5O6 and a molecular weight of 473.45 g/mol. Its IUPAC name is (2R)-3-(2,4-dioxopteridin-1-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2R)-3-(2,4-dioxopteridin-1-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 101196616 |
| Molecular Formula | C24H19N5O6 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | (2R)-3-(2,4-dioxopteridin-1-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(N[C@H](Cn1c(=O)[nH]c(=O)c2nccnc21)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H19N5O6/c30-21-19-20(26-10-9-25-19)29(23(33)28-21)11-18(22(31)32)27-24(34)35-12-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-10,17-18H,11-12H2,(H,27,34)(H,31,32)(H,28,30,33)/t18-/m1/s1 |
| InChIKey | MUYDPYXNGWEYAI-GOSISDBHSA-N |
| XLogP | 1.47 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |