C21H18N4O6 — CID 146013808
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitroimidazol-1-yl)propanoic acid (PubChem CID 146013808) has the molecular formula C21H18N4O6 and a molecular weight of 422.40 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitroimidazol-1-yl)propanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitroimidazol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 146013808 |
| Molecular Formula | C21H18N4O6 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitroimidazol-1-yl)propanoic acid |
| SMILES | O=C(N[C@@H](Cn1ccnc1[N+](=O)[O-])C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H18N4O6/c26-19(27)18(11-24-10-9-22-20(24)25(29)30)23-21(28)31-12-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-10,17-18H,11-12H2,(H,23,28)(H,26,27)/t18-/m0/s1 |
| InChIKey | ZGOUHFXAOVRQCM-SFHVURJKSA-N |
| XLogP | 2.78 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|