C22H20N4O6 — CID 146013137
(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitroimidazol-1-yl)butanoic acid (PubChem CID 146013137) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitroimidazol-1-yl)butanoic acid.
| Compound Name | (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitroimidazol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 146013137 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitroimidazol-1-yl)butanoic acid |
| SMILES | C[C@@H]([C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)n1ccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20N4O6/c1-13(25-11-10-23-21(25)26(30)31)19(20(27)28)24-22(29)32-12-18-16-8-4-2-6-14(16)15-7-3-5-9-17(15)18/h2-11,13,18-19H,12H2,1H3,(H,24,29)(H,27,28)/t13-,19-/m0/s1 |
| InChIKey | IEQBNBPHPRUQAE-DJJJIMSYSA-N |
| XLogP | 3.34 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|