C36H63NSi3 — CID 101198614
5-tri(propan-2-yl)silyl-2,3-bis[2-tri(propan-2-yl)silylethynyl]pent-2-en-4-ynenitrile (PubChem CID 101198614) has the molecular formula C36H63NSi3 and a molecular weight of 594.17 g/mol. Its IUPAC name is 5-tri(propan-2-yl)silyl-2,3-bis[2-tri(propan-2-yl)silylethynyl]pent-2-en-4-ynenitrile.
| Compound Name | 5-tri(propan-2-yl)silyl-2,3-bis[2-tri(propan-2-yl)silylethynyl]pent-2-en-4-ynenitrile |
|---|---|
| PubChem CID | 101198614 |
| Molecular Formula | C36H63NSi3 |
| Molecular Weight | 594.17 g/mol |
| Exact Mass | 593.43 |
| IUPAC Name | 5-tri(propan-2-yl)silyl-2,3-bis[2-tri(propan-2-yl)silylethynyl]pent-2-en-4-ynenitrile |
| SMILES | CC(C)[Si](C#CC(C#N)=C(C#C[Si](C(C)C)(C(C)C)C(C)C)C#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H63NSi3/c1-26(2)38(27(3)4,28(5)6)22-19-35(20-23-39(29(7)8,30(9)10)31(11)12)36(25-37)21-24-40(32(13)14,33(15)16)34(17)18/h26-34H,1-18H3 |
| InChIKey | RGXOQRKSUXROPS-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.17 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|