C33H57NSi3 — CID 101198615
(Z)-3-(2-triethylsilylethynyl)-5-tri(propan-2-yl)silyl-2-[2-tri(propan-2-yl)silylethynyl]pent-2-en-4-ynenitrile (PubChem CID 101198615) has the molecular formula C33H57NSi3 and a molecular weight of 552.08 g/mol. Its IUPAC name is (Z)-3-(2-triethylsilylethynyl)-5-tri(propan-2-yl)silyl-2-[2-tri(propan-2-yl)silylethynyl]pent-2-en-4-ynenitrile.
| Compound Name | (Z)-3-(2-triethylsilylethynyl)-5-tri(propan-2-yl)silyl-2-[2-tri(propan-2-yl)silylethynyl]pent-2-en-4-ynenitrile |
|---|---|
| PubChem CID | 101198615 |
| Molecular Formula | C33H57NSi3 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.38 |
| IUPAC Name | (Z)-3-(2-triethylsilylethynyl)-5-tri(propan-2-yl)silyl-2-[2-tri(propan-2-yl)silylethynyl]pent-2-en-4-ynenitrile |
| SMILES | CC[Si](C#C/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(/C#N)C#C[Si](C(C)C)(C(C)C)C(C)C)(CC)CC |
| InChI | InChI=1S/C33H57NSi3/c1-16-35(17-2,18-3)22-19-32(20-23-36(26(4)5,27(6)7)28(8)9)33(25-34)21-24-37(29(10)11,30(12)13)31(14)15/h26-31H,16-18H2,1-15H3/b33-32- |
| InChIKey | HNKIUJDMDZAGCV-KARKAFJISA-N |
| XLogP | 10.30 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|