C15H23NO3 — CID 101200287
(1R,2R,3R,4R,6R)-4-methyl-6-(2-phenylethylamino)cyclohexane-1,2,3-triol (PubChem CID 101200287) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (1R,2R,3R,4R,6R)-4-methyl-6-(2-phenylethylamino)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2R,3R,4R,6R)-4-methyl-6-(2-phenylethylamino)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 101200287 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (1R,2R,3R,4R,6R)-4-methyl-6-(2-phenylethylamino)cyclohexane-1,2,3-triol |
| SMILES | C[C@@H]1C[C@@H](NCCc2ccccc2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H23NO3/c1-10-9-12(14(18)15(19)13(10)17)16-8-7-11-5-3-2-4-6-11/h2-6,10,12-19H,7-9H2,1H3/t10-,12-,13-,14-,15-/m1/s1 |
| InChIKey | AYJDCDFTVZFKTB-DIAXPKBXSA-N |
| XLogP | 0.31 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |