About (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide
(Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide (PubChem CID 101200706) has the molecular formula C12H22N2O4
and a molecular weight of 258.32 g/mol. Its IUPAC name is (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide.
Molecular Properties
| Compound Name | (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide |
| PubChem CID | 101200706 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide |
| SMILES | CNC(=O)C(C)C(O)/C=C\C(O)C(C)NC(C)=O |
| InChI | InChI=1S/C12H22N2O4/c1-7(12(18)13-4)10(16)5-6-11(17)8(2)14-9(3)15/h5-8,10-11,16-17H,1-4H3,(H,13,18)(H,14,15)/b6-5- |
| InChIKey | CRBSFRWPZGEVGR-WAYWQWQTSA-N |
| XLogP | -0.83 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide?
The IUPAC name of (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide (CID 101200706) is (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide.
What is the SMILES notation for (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide?
The canonical SMILES for (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide is CNC(=O)C(C)C(O)/C=C\C(O)C(C)NC(C)=O.
What is the InChIKey of (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide?
The InChIKey is CRBSFRWPZGEVGR-WAYWQWQTSA-N. The full InChI is InChI=1S/C12H22N2O4/c1-7(12(18)13-4)10(16)5-6-11(17)8(2)14-9(3)15/h5-8,10-11,16-17H,1-4H3,(H,13,18)(H,14,15)/b6-5-.
What are the key properties of (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide?
(Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide has a molecular weight of 258.32 g/mol, XLogP of -0.83, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-7-acetamido-3,6-dihydroxy-N,2-dimethyloct-4-enamide is sourced from PubChem (CID 101200706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).