C15H8ClIO3 — CID 101202383
6-chloro-3-(phenyl-λ3-iodanylidene)chromene-2,4-dione (PubChem CID 101202383) has the molecular formula C15H8ClIO3 and a molecular weight of 398.58 g/mol. Its IUPAC name is 6-chloro-3-(phenyl-λ3-iodanylidene)chromene-2,4-dione.
| Compound Name | 6-chloro-3-(phenyl-λ3-iodanylidene)chromene-2,4-dione |
|---|---|
| PubChem CID | 101202383 |
| Molecular Formula | C15H8ClIO3 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | 6-chloro-3-(phenyl-λ3-iodanylidene)chromene-2,4-dione |
| SMILES | O=C1Oc2ccc(Cl)cc2C(=O)/C1=I/c1ccccc1 |
| InChI | InChI=1S/C15H8ClIO3/c16-9-6-7-12-11(8-9)14(18)13(15(19)20-12)17-10-4-2-1-3-5-10/h1-8H |
| InChIKey | RSPCQISGWYOBKM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|