C17H13IO3 — CID 14959974
2-methyl-4-(phenyl-lambda3-iodanylidene)-1-benzoxepine-3,5-dione (PubChem CID 14959974) has the molecular formula C17H13IO3 and a molecular weight of 392.19 g/mol. Its IUPAC name is 2-methyl-4-(phenyl-lambda3-iodanylidene)-1-benzoxepine-3,5-dione.
| Compound Name | 2-methyl-4-(phenyl-lambda3-iodanylidene)-1-benzoxepine-3,5-dione |
|---|---|
| PubChem CID | 14959974 |
| Molecular Formula | C17H13IO3 |
| Molecular Weight | 392.19 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 2-methyl-4-(phenyl-lambda3-iodanylidene)-1-benzoxepine-3,5-dione |
| SMILES | CC1Oc2ccccc2C(=O)/C(=I/c2ccccc2)C1=O |
| InChI | InChI=1S/C17H13IO3/c1-11-16(19)15(18-12-7-3-2-4-8-12)17(20)13-9-5-6-10-14(13)21-11/h2-11H,1H3 |
| InChIKey | FTNKZNBUNVOOTE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.19 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|