C11H21NO — CID 101202697
(Z,2E)-3-ethoxy-2-ethylidene-N,N-dimethylpent-3-en-1-amine (PubChem CID 101202697) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (Z,2E)-3-ethoxy-2-ethylidene-N,N-dimethylpent-3-en-1-amine.
| Compound Name | (Z,2E)-3-ethoxy-2-ethylidene-N,N-dimethylpent-3-en-1-amine |
|---|---|
| PubChem CID | 101202697 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (Z,2E)-3-ethoxy-2-ethylidene-N,N-dimethylpent-3-en-1-amine |
| SMILES | C/C=C(OCC)/C(=C/C)CN(C)C |
| InChI | InChI=1S/C11H21NO/c1-6-10(9-12(4)5)11(7-2)13-8-3/h6-7H,8-9H2,1-5H3/b10-6+,11-7- |
| InChIKey | JDAIWJPRSFPGEN-QZTBCQRESA-N |
| XLogP | 2.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|