C33H45FO5 — CID 101206821
[(2S)-octan-2-yl] 2-fluoro-4-[(E)-3-(4-nonoxyphenyl)prop-2-enoyl]oxybenzoate (PubChem CID 101206821) has the molecular formula C33H45FO5 and a molecular weight of 540.72 g/mol. Its IUPAC name is [(2S)-octan-2-yl] 2-fluoro-4-[(E)-3-(4-nonoxyphenyl)prop-2-enoyl]oxybenzoate.
| Compound Name | [(2S)-octan-2-yl] 2-fluoro-4-[(E)-3-(4-nonoxyphenyl)prop-2-enoyl]oxybenzoate |
|---|---|
| PubChem CID | 101206821 |
| Molecular Formula | C33H45FO5 |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | [(2S)-octan-2-yl] 2-fluoro-4-[(E)-3-(4-nonoxyphenyl)prop-2-enoyl]oxybenzoate |
| SMILES | CCCCCCCCCOc1ccc(/C=C/C(=O)Oc2ccc(C(=O)O[C@@H](C)CCCCCC)c(F)c2)cc1 |
| InChI | InChI=1S/C33H45FO5/c1-4-6-8-10-11-12-14-24-37-28-19-16-27(17-20-28)18-23-32(35)39-29-21-22-30(31(34)25-29)33(36)38-26(3)15-13-9-7-5-2/h16-23,25-26H,4-15,24H2,1-3H3/b23-18+/t26-/m0/s1 |
| InChIKey | JMMLPEFQYVSUMK-GRVBVBMHSA-N |
| XLogP | 9.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|