C30H30FN3O8 — CID 10120963
(4S,4aS,5aR,12aS)-9-(acetamidomethyl)-4-(dimethylamino)-7-(4-fluorophenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 10120963) has the molecular formula C30H30FN3O8 and a molecular weight of 579.58 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-9-(acetamidomethyl)-4-(dimethylamino)-7-(4-fluorophenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-9-(acetamidomethyl)-4-(dimethylamino)-7-(4-fluorophenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 10120963 |
| Molecular Formula | C30H30FN3O8 |
| Molecular Weight | 579.58 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | (4S,4aS,5aR,12aS)-9-(acetamidomethyl)-4-(dimethylamino)-7-(4-fluorophenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(=O)NCc1cc(-c2ccc(F)cc2)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C30H30FN3O8/c1-12(35)33-11-15-9-17(13-4-6-16(31)7-5-13)18-8-14-10-19-23(34(2)3)26(38)22(29(32)41)28(40)30(19,42)27(39)20(14)25(37)21(18)24(15)36/h4-7,9,14,19-20,22-23,36,42H,8,10-11H2,1-3H3,(H2,32,41)(H,33,35)/t14-,19-,20?,22?,23-,30-/m0/s1 |
| InChIKey | XEFYYINZMFEFGB-BROMSOABSA-N |
| XLogP | 0.31 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.58 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|