C23H22N4O5 — CID 101210485
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[2-(1,10-phenanthrolin-3-yl)ethyl]pyrimidine-2,4-dione (PubChem CID 101210485) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[2-(1,10-phenanthrolin-3-yl)ethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[2-(1,10-phenanthrolin-3-yl)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101210485 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[2-(1,10-phenanthrolin-3-yl)ethyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1CCc1cnc2c(ccc3cccnc32)c1 |
| InChI | InChI=1S/C23H22N4O5/c28-12-18-17(29)9-19(32-18)27-11-16(22(30)26-23(27)31)4-3-13-8-15-6-5-14-2-1-7-24-20(14)21(15)25-10-13/h1-2,5-8,10-11,17-19,28-29H,3-4,9,12H2,(H,26,30,31)/t17-,18+,19+/m0/s1 |
| InChIKey | LRTFUDFOXKQQJV-IPMKNSEASA-N |
| XLogP | 1.06 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|