C21H36Si2 — CID 101212825
(3,5-ditert-butyl-7-trimethylsilylhepta-3,4-dien-1,6-diynyl)-trimethylsilane (PubChem CID 101212825) has the molecular formula C21H36Si2 and a molecular weight of 344.69 g/mol. Its IUPAC name is (3,5-ditert-butyl-7-trimethylsilylhepta-3,4-dien-1,6-diynyl)-trimethylsilane.
| Compound Name | (3,5-ditert-butyl-7-trimethylsilylhepta-3,4-dien-1,6-diynyl)-trimethylsilane |
|---|---|
| PubChem CID | 101212825 |
| Molecular Formula | C21H36Si2 |
| Molecular Weight | 344.69 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (3,5-ditert-butyl-7-trimethylsilylhepta-3,4-dien-1,6-diynyl)-trimethylsilane |
| SMILES | CC(C)(C)C(=C=C(C#C[Si](C)(C)C)C(C)(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C21H36Si2/c1-20(2,3)18(13-15-22(7,8)9)17-19(21(4,5)6)14-16-23(10,11)12/h1-12H3 |
| InChIKey | PYSRLGYAZCZEFF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.69 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|