C16H26O3 — CID 101213244
tert-butyl (5S)-1-hydroxy-2,2-dimethyl-1,3,4,5,6,7-hexahydroindene-5-carboxylate (PubChem CID 101213244) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is tert-butyl (5S)-1-hydroxy-2,2-dimethyl-1,3,4,5,6,7-hexahydroindene-5-carboxylate.
| Compound Name | tert-butyl (5S)-1-hydroxy-2,2-dimethyl-1,3,4,5,6,7-hexahydroindene-5-carboxylate |
|---|---|
| PubChem CID | 101213244 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | tert-butyl (5S)-1-hydroxy-2,2-dimethyl-1,3,4,5,6,7-hexahydroindene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCC2=C(C1)CC(C)(C)C2O |
| InChI | InChI=1S/C16H26O3/c1-15(2,3)19-14(18)10-6-7-12-11(8-10)9-16(4,5)13(12)17/h10,13,17H,6-9H2,1-5H3/t10-,13?/m0/s1 |
| InChIKey | MTOCKZSCVJKUAM-NKUHCKNESA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|