C16H24O3 — CID 59672160
methyl (3S,6S,8R,10S)-3-hydroxy-2,6,10-trimethyltricyclo[6.3.0.03,6]undec-1-ene-10-carboxylate (PubChem CID 59672160) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is methyl (3S,6S,8R,10S)-3-hydroxy-2,6,10-trimethyltricyclo[6.3.0.03,6]undec-1-ene-10-carboxylate.
| Compound Name | methyl (3S,6S,8R,10S)-3-hydroxy-2,6,10-trimethyltricyclo[6.3.0.03,6]undec-1-ene-10-carboxylate |
|---|---|
| PubChem CID | 59672160 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl (3S,6S,8R,10S)-3-hydroxy-2,6,10-trimethyltricyclo[6.3.0.03,6]undec-1-ene-10-carboxylate |
| SMILES | COC(=O)[C@]1(C)CC2=C(C)[C@]3(O)CC[C@@]3(C)C[C@@H]2C1 |
| InChI | InChI=1S/C16H24O3/c1-10-12-9-14(2,13(17)19-4)7-11(12)8-15(3)5-6-16(10,15)18/h11,18H,5-9H2,1-4H3/t11-,14-,15-,16+/m0/s1 |
| InChIKey | CNROOTJCSCFYPM-VCOSZWKGSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|