C39H50N2O2+2 — CID 101215737
dibenzyl-[[(4S,5S)-2-tert-butyl-5-[[dibenzyl(methyl)azaniumyl]methyl]-1,3-dioxolan-4-yl]methyl]-methylazanium (PubChem CID 101215737) has the molecular formula C39H50N2O2+2 and a molecular weight of 578.84 g/mol. Its IUPAC name is dibenzyl-[[(4S,5S)-2-tert-butyl-5-[[dibenzyl(methyl)azaniumyl]methyl]-1,3-dioxolan-4-yl]methyl]-methylazanium.
| Compound Name | dibenzyl-[[(4S,5S)-2-tert-butyl-5-[[dibenzyl(methyl)azaniumyl]methyl]-1,3-dioxolan-4-yl]methyl]-methylazanium |
|---|---|
| PubChem CID | 101215737 |
| Molecular Formula | C39H50N2O2+2 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.39 |
| IUPAC Name | dibenzyl-[[(4S,5S)-2-tert-butyl-5-[[dibenzyl(methyl)azaniumyl]methyl]-1,3-dioxolan-4-yl]methyl]-methylazanium |
| SMILES | CC(C)(C)C1O[C@@H](C[N+](C)(Cc2ccccc2)Cc2ccccc2)[C@H](C[N+](C)(Cc2ccccc2)Cc2ccccc2)O1 |
| InChI | InChI=1S/C39H50N2O2/c1-39(2,3)38-42-36(30-40(4,26-32-18-10-6-11-19-32)27-33-20-12-7-13-21-33)37(43-38)31-41(5,28-34-22-14-8-15-23-34)29-35-24-16-9-17-25-35/h6-25,36-38H,26-31H2,1-5H3/q+2/t36-,37-/m0/s1 |
| InChIKey | ZGMYOUJNZIATHG-BCRBLDSWSA-N |
| XLogP | 7.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|