C21H32O2 — CID 11034443
(2R,4R,5R,6R)-4-[(2S)-but-3-en-2-yl]-2-tert-butyl-5-methyl-6-(2-phenylethyl)-1,3-dioxane (PubChem CID 11034443) has the molecular formula C21H32O2 and a molecular weight of 316.48 g/mol. Its IUPAC name is (2R,4R,5R,6R)-4-[(2S)-but-3-en-2-yl]-2-tert-butyl-5-methyl-6-(2-phenylethyl)-1,3-dioxane.
| Compound Name | (2R,4R,5R,6R)-4-[(2S)-but-3-en-2-yl]-2-tert-butyl-5-methyl-6-(2-phenylethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 11034443 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (2R,4R,5R,6R)-4-[(2S)-but-3-en-2-yl]-2-tert-butyl-5-methyl-6-(2-phenylethyl)-1,3-dioxane |
| SMILES | C=C[C@H](C)[C@H]1O[C@H](C(C)(C)C)O[C@H](CCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C21H32O2/c1-7-15(2)19-16(3)18(22-20(23-19)21(4,5)6)14-13-17-11-9-8-10-12-17/h7-12,15-16,18-20H,1,13-14H2,2-6H3/t15-,16+,18+,19+,20+/m0/s1 |
| InChIKey | OSCPKWWPWBDVFH-APQLOABGSA-N |
| XLogP | 5.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|