C31H38FN5O6S — CID 10121978
[2-[4-[2-fluoro-4-[(5S)-2-oxo-5-[(propanethioylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl] 3-(morpholin-4-ylmethyl)benzoate (PubChem CID 10121978) has the molecular formula C31H38FN5O6S and a molecular weight of 627.74 g/mol. Its IUPAC name is [2-[4-[2-fluoro-4-[(5S)-2-oxo-5-[(propanethioylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl] 3-(morpholin-4-ylmethyl)benzoate.
| Compound Name | [2-[4-[2-fluoro-4-[(5S)-2-oxo-5-[(propanethioylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl] 3-(morpholin-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 10121978 |
| Molecular Formula | C31H38FN5O6S |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.25 |
| IUPAC Name | [2-[4-[2-fluoro-4-[(5S)-2-oxo-5-[(propanethioylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl] 3-(morpholin-4-ylmethyl)benzoate |
| SMILES | CCC(=S)NC[C@H]1CN(c2ccc(N3CCN(C(=O)COC(=O)c4cccc(CN5CCOCC5)c4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C31H38FN5O6S/c1-2-28(44)33-18-25-20-37(31(40)43-25)24-6-7-27(26(32)17-24)35-8-10-36(11-9-35)29(38)21-42-30(39)23-5-3-4-22(16-23)19-34-12-14-41-15-13-34/h3-7,16-17,25H,2,8-15,18-21H2,1H3,(H,33,44)/t25-/m0/s1 |
| InChIKey | KRGSXEZHJCZWAK-VWLOTQADSA-N |
| XLogP | 2.82 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|