C15H17N3O6S — CID 101222536
(5S)-2-[2-(benzenesulfonyl)ethyl]-1,3-dioxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxylic acid (PubChem CID 101222536) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is (5S)-2-[2-(benzenesulfonyl)ethyl]-1,3-dioxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxylic acid.
| Compound Name | (5S)-2-[2-(benzenesulfonyl)ethyl]-1,3-dioxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxylic acid |
|---|---|
| PubChem CID | 101222536 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (5S)-2-[2-(benzenesulfonyl)ethyl]-1,3-dioxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazine-5-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCn2c(=O)n(CCS(=O)(=O)c3ccccc3)c(=O)n21 |
| InChI | InChI=1S/C15H17N3O6S/c19-13(20)12-7-4-8-17-14(21)16(15(22)18(12)17)9-10-25(23,24)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,19,20)/t12-/m0/s1 |
| InChIKey | RYHGHNITZXIWBP-LBPRGKRZSA-N |
| XLogP | -0.30 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |