C24H42O4Si2 — CID 101222737
[4-[dimethyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]silyl]phenyl]-dimethyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]silane (PubChem CID 101222737) has the molecular formula C24H42O4Si2 and a molecular weight of 450.77 g/mol. Its IUPAC name is [4-[dimethyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]silyl]phenyl]-dimethyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]silane.
| Compound Name | [4-[dimethyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]silyl]phenyl]-dimethyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]silane |
|---|---|
| PubChem CID | 101222737 |
| Molecular Formula | C24H42O4Si2 |
| Molecular Weight | 450.77 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | [4-[dimethyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]silyl]phenyl]-dimethyl-[3-[(2-methyloxiran-2-yl)methoxy]propyl]silane |
| SMILES | CC1(COCCC[Si](C)(C)c2ccc([Si](C)(C)CCCOCC3(C)CO3)cc2)CO1 |
| InChI | InChI=1S/C24H42O4Si2/c1-23(19-27-23)17-25-13-7-15-29(3,4)21-9-11-22(12-10-21)30(5,6)16-8-14-26-18-24(2)20-28-24/h9-12H,7-8,13-20H2,1-6H3 |
| InChIKey | ULINHNQMOOPKSA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|