C18H20O5S — CID 101225525
dimethyl 2-ethenyl-5-[(E)-2-phenylsulfanylethenyl]oxolane-3,4-dicarboxylate (PubChem CID 101225525) has the molecular formula C18H20O5S and a molecular weight of 348.42 g/mol. Its IUPAC name is dimethyl 2-ethenyl-5-[(E)-2-phenylsulfanylethenyl]oxolane-3,4-dicarboxylate.
| Compound Name | dimethyl 2-ethenyl-5-[(E)-2-phenylsulfanylethenyl]oxolane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101225525 |
| Molecular Formula | C18H20O5S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | dimethyl 2-ethenyl-5-[(E)-2-phenylsulfanylethenyl]oxolane-3,4-dicarboxylate |
| SMILES | C=CC1OC(/C=C/Sc2ccccc2)C(C(=O)OC)C1C(=O)OC |
| InChI | InChI=1S/C18H20O5S/c1-4-13-15(17(19)21-2)16(18(20)22-3)14(23-13)10-11-24-12-8-6-5-7-9-12/h4-11,13-16H,1H2,2-3H3/b11-10+ |
| InChIKey | VPYYMVXTVRBJQA-ZHACJKMWSA-N |
| XLogP | 2.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|