C39H38O10 — CID 101226598
[(3aS,5R,6R,7S,7aR)-6,7-dibenzoyloxy-2-pentoxy-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate (PubChem CID 101226598) has the molecular formula C39H38O10 and a molecular weight of 666.72 g/mol. Its IUPAC name is [(3aS,5R,6R,7S,7aR)-6,7-dibenzoyloxy-2-pentoxy-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate.
| Compound Name | [(3aS,5R,6R,7S,7aR)-6,7-dibenzoyloxy-2-pentoxy-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 101226598 |
| Molecular Formula | C39H38O10 |
| Molecular Weight | 666.72 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | [(3aS,5R,6R,7S,7aR)-6,7-dibenzoyloxy-2-pentoxy-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate |
| SMILES | CCCCCOC1(c2ccccc2)O[C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C39H38O10/c1-2-3-16-25-44-39(30-23-14-7-15-24-30)48-34-33(47-37(42)29-21-12-6-13-22-29)32(46-36(41)28-19-10-5-11-20-28)31(45-38(34)49-39)26-43-35(40)27-17-8-4-9-18-27/h4-15,17-24,31-34,38H,2-3,16,25-26H2,1H3/t31-,32-,33+,34-,38+,39?/m1/s1 |
| InChIKey | VVGUDWYIZTZBML-PPDDGGMJSA-N |
| XLogP | 6.45 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.72 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|