C42H37N3O13 — CID 59035724
[2-[[(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy]-6,7-dibenzoyloxy-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate (PubChem CID 59035724) has the molecular formula C42H37N3O13 and a molecular weight of 791.77 g/mol. Its IUPAC name is [2-[[(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy]-6,7-dibenzoyloxy-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate.
| Compound Name | [2-[[(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy]-6,7-dibenzoyloxy-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 59035724 |
| Molecular Formula | C42H37N3O13 |
| Molecular Weight | 791.77 g/mol |
| Exact Mass | 791.23 |
| IUPAC Name | [2-[[(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methoxy]-6,7-dibenzoyloxy-2-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]methyl benzoate |
| SMILES | Nc1ccn([C@@H]2CO[C@H](COC3(c4ccccc4)OC4OC(COC(=O)c5ccccc5)C(OC(=O)c5ccccc5)C(OC(=O)c5ccccc5)C4O3)O2)c(=O)n1 |
| InChI | InChI=1S/C42H37N3O13/c43-31-21-22-45(41(49)44-31)32-24-50-33(54-32)25-52-42(29-19-11-4-12-20-29)57-36-35(56-39(48)28-17-9-3-10-18-28)34(55-38(47)27-15-7-2-8-16-27)30(53-40(36)58-42)23-51-37(46)26-13-5-1-6-14-26/h1-22,30,32-36,40H,23-25H2,(H2,43,44,49)/t30?,32-,33-,34?,35?,36?,40?,42?/m0/s1 |
| InChIKey | DDUTYCNHKSHVMJ-NXKUOUGGSA-N |
| XLogP | 3.97 |
| TPSA | 195.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|