C15H18O2 — CID 101227138
(3S)-2',2',5-trimethylspiro[1-benzofuran-3,1'-cyclopentane]-2-one (PubChem CID 101227138) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (3S)-2',2',5-trimethylspiro[1-benzofuran-3,1'-cyclopentane]-2-one.
| Compound Name | (3S)-2',2',5-trimethylspiro[1-benzofuran-3,1'-cyclopentane]-2-one |
|---|---|
| PubChem CID | 101227138 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (3S)-2',2',5-trimethylspiro[1-benzofuran-3,1'-cyclopentane]-2-one |
| SMILES | Cc1ccc2c(c1)[C@@]1(CCCC1(C)C)C(=O)O2 |
| InChI | InChI=1S/C15H18O2/c1-10-5-6-12-11(9-10)15(13(16)17-12)8-4-7-14(15,2)3/h5-6,9H,4,7-8H2,1-3H3/t15-/m0/s1 |
| InChIKey | NIGQROUGVCTXOV-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|