C15H20O2 — CID 101223313
cis-(1R,2R)-2-(2-hydroxy-5-methylphenyl)-1,2-dimethylcyclopentane-1-carbaldehyde (PubChem CID 101223313) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is cis-(1R,2R)-2-(2-hydroxy-5-methylphenyl)-1,2-dimethylcyclopentane-1-carbaldehyde.
| Compound Name | cis-(1R,2R)-2-(2-hydroxy-5-methylphenyl)-1,2-dimethylcyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 101223313 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | cis-(1R,2R)-2-(2-hydroxy-5-methylphenyl)-1,2-dimethylcyclopentane-1-carbaldehyde |
| SMILES | Cc1ccc(O)c([C@@]2(C)CCC[C@@]2(C)C=O)c1 |
| InChI | InChI=1S/C15H20O2/c1-11-5-6-13(17)12(9-11)15(3)8-4-7-14(15,2)10-16/h5-6,9-10,17H,4,7-8H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | HPALCXSDHIFKMQ-LSDHHAIUSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|