C15H20S — CID 102370773
(3aR,9bS)-3a,7,9b-trimethyl-1,2,3,4-tetrahydrocyclopenta[c]thiochromene (PubChem CID 102370773) has the molecular formula C15H20S and a molecular weight of 232.39 g/mol. Its IUPAC name is (3aR,9bS)-3a,7,9b-trimethyl-1,2,3,4-tetrahydrocyclopenta[c]thiochromene.
| Compound Name | (3aR,9bS)-3a,7,9b-trimethyl-1,2,3,4-tetrahydrocyclopenta[c]thiochromene |
|---|---|
| PubChem CID | 102370773 |
| Molecular Formula | C15H20S |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (3aR,9bS)-3a,7,9b-trimethyl-1,2,3,4-tetrahydrocyclopenta[c]thiochromene |
| SMILES | Cc1ccc2c(c1)SC[C@]1(C)CCC[C@]21C |
| InChI | InChI=1S/C15H20S/c1-11-5-6-12-13(9-11)16-10-14(2)7-4-8-15(12,14)3/h5-6,9H,4,7-8,10H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | HVWHUGRWAKPABA-LSDHHAIUSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |