C18H18OS — CID 59079081
(3S)-3,7-dimethyl-3-(4-methylphenyl)-2H-thiochromen-4-one (PubChem CID 59079081) has the molecular formula C18H18OS and a molecular weight of 282.41 g/mol. Its IUPAC name is (3S)-3,7-dimethyl-3-(4-methylphenyl)-2H-thiochromen-4-one.
| Compound Name | (3S)-3,7-dimethyl-3-(4-methylphenyl)-2H-thiochromen-4-one |
|---|---|
| PubChem CID | 59079081 |
| Molecular Formula | C18H18OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (3S)-3,7-dimethyl-3-(4-methylphenyl)-2H-thiochromen-4-one |
| SMILES | Cc1ccc([C@]2(C)CSc3cc(C)ccc3C2=O)cc1 |
| InChI | InChI=1S/C18H18OS/c1-12-4-7-14(8-5-12)18(3)11-20-16-10-13(2)6-9-15(16)17(18)19/h4-10H,11H2,1-3H3/t18-/m0/s1 |
| InChIKey | QLIKUQPXEMFGJY-SFHVURJKSA-N |
| XLogP | 4.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |