C40H43OPrS2- — CID 158776571
(4S)-7-methyl-3-(4-methylphenyl)-4-prop-2-enyl-2,4-dihydrothiochromen-3-ide;7-methyl-3-(4-methylphenyl)-3-propyl-2H-thiochromen-4-one;praseodymium (PubChem CID 158776571) has the molecular formula C40H43OPrS2- and a molecular weight of 744.83 g/mol. Its IUPAC name is (4S)-7-methyl-3-(4-methylphenyl)-4-prop-2-enyl-2,4-dihydrothiochromen-3-ide;7-methyl-3-(4-methylphenyl)-3-propyl-2H-thiochromen-4-one;praseodymium.
| Compound Name | (4S)-7-methyl-3-(4-methylphenyl)-4-prop-2-enyl-2,4-dihydrothiochromen-3-ide;7-methyl-3-(4-methylphenyl)-3-propyl-2H-thiochromen-4-one;praseodymium |
|---|---|
| PubChem CID | 158776571 |
| Molecular Formula | C40H43OPrS2- |
| Molecular Weight | 744.83 g/mol |
| Exact Mass | 744.18 |
| IUPAC Name | (4S)-7-methyl-3-(4-methylphenyl)-4-prop-2-enyl-2,4-dihydrothiochromen-3-ide;7-methyl-3-(4-methylphenyl)-3-propyl-2H-thiochromen-4-one;praseodymium |
| SMILES | C=CC[C@@H]1c2ccc(C)cc2SC[C-]1c1ccc(C)cc1.CCCC1(c2ccc(C)cc2)CSc2cc(C)ccc2C1=O.[Pr] |
| InChI | InChI=1S/C20H22OS.C20H21S.Pr/c1-4-11-20(16-8-5-14(2)6-9-16)13-22-18-12-15(3)7-10-17(18)19(20)21;1-4-5-17-18-11-8-15(3)12-20(18)21-13-19(17)16-9-6-14(2)7-10-16;/h5-10,12H,4,11,13H2,1-3H3;4,6-12,17H,1,5,13H2,2-3H3;/q;-1;/t;17-;/m.1./s1 |
| InChIKey | GNDCMIOVDUAYQJ-VVARQKSHSA-N |
| XLogP | 11.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.83 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|