C15H21N3O6 — CID 101227266
methyl 2-[2-[2-hydroxy-4-(phenylmethoxycarbonylamino)butanoyl]hydrazinyl]acetate (PubChem CID 101227266) has the molecular formula C15H21N3O6 and a molecular weight of 339.35 g/mol. Its IUPAC name is methyl 2-[2-[2-hydroxy-4-(phenylmethoxycarbonylamino)butanoyl]hydrazinyl]acetate.
| Compound Name | methyl 2-[2-[2-hydroxy-4-(phenylmethoxycarbonylamino)butanoyl]hydrazinyl]acetate |
|---|---|
| PubChem CID | 101227266 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | methyl 2-[2-[2-hydroxy-4-(phenylmethoxycarbonylamino)butanoyl]hydrazinyl]acetate |
| SMILES | COC(=O)CNNC(=O)C(O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21N3O6/c1-23-13(20)9-17-18-14(21)12(19)7-8-16-15(22)24-10-11-5-3-2-4-6-11/h2-6,12,17,19H,7-10H2,1H3,(H,16,22)(H,18,21) |
| InChIKey | VJFMXZRFUYWRGA-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|