C25H29N2OP — CID 101230843
[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrol-1-yl]-bis(2-methylphenyl)phosphane (PubChem CID 101230843) has the molecular formula C25H29N2OP and a molecular weight of 404.49 g/mol. Its IUPAC name is [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrol-1-yl]-bis(2-methylphenyl)phosphane.
| Compound Name | [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrol-1-yl]-bis(2-methylphenyl)phosphane |
|---|---|
| PubChem CID | 101230843 |
| Molecular Formula | C25H29N2OP |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrol-1-yl]-bis(2-methylphenyl)phosphane |
| SMILES | Cc1ccccc1P(c1ccccc1C)n1cccc1C1=N[C@@H](C(C)(C)C)CO1 |
| InChI | InChI=1S/C25H29N2OP/c1-18-11-6-8-14-21(18)29(22-15-9-7-12-19(22)2)27-16-10-13-20(27)24-26-23(17-28-24)25(3,4)5/h6-16,23H,17H2,1-5H3/t23-/m1/s1 |
| InChIKey | IVQISQPUZHYULS-HSZRJFAPSA-N |
| XLogP | 5.19 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|