C19H28OSi — CID 101231317
3-phenyl-2-tri(propan-2-yl)silylbuta-1,3-dien-1-one (PubChem CID 101231317) has the molecular formula C19H28OSi and a molecular weight of 300.52 g/mol. Its IUPAC name is 3-phenyl-2-tri(propan-2-yl)silylbuta-1,3-dien-1-one.
| Compound Name | 3-phenyl-2-tri(propan-2-yl)silylbuta-1,3-dien-1-one |
|---|---|
| PubChem CID | 101231317 |
| Molecular Formula | C19H28OSi |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 3-phenyl-2-tri(propan-2-yl)silylbuta-1,3-dien-1-one |
| SMILES | C=C(C(=C=O)[Si](C(C)C)(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H28OSi/c1-14(2)21(15(3)4,16(5)6)19(13-20)17(7)18-11-9-8-10-12-18/h8-12,14-16H,7H2,1-6H3 |
| InChIKey | FXKIBMQQTQDVKA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|