C24H34OSi — CID 102344932
1,1-diphenyl-2-tri(propan-2-yl)silylprop-2-en-1-ol (PubChem CID 102344932) has the molecular formula C24H34OSi and a molecular weight of 366.62 g/mol. Its IUPAC name is 1,1-diphenyl-2-tri(propan-2-yl)silylprop-2-en-1-ol.
| Compound Name | 1,1-diphenyl-2-tri(propan-2-yl)silylprop-2-en-1-ol |
|---|---|
| PubChem CID | 102344932 |
| Molecular Formula | C24H34OSi |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1,1-diphenyl-2-tri(propan-2-yl)silylprop-2-en-1-ol |
| SMILES | C=C(C(O)(c1ccccc1)c1ccccc1)[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H34OSi/c1-18(2)26(19(3)4,20(5)6)21(7)24(25,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-20,25H,7H2,1-6H3 |
| InChIKey | SRTLETMABBKVBU-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|