C15H30O4Si — CID 101232089
(2R,3S,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-prop-2-enyloxan-4-ol (PubChem CID 101232089) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-prop-2-enyloxan-4-ol.
| Compound Name | (2R,3S,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-prop-2-enyloxan-4-ol |
|---|---|
| PubChem CID | 101232089 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2R,3S,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-prop-2-enyloxan-4-ol |
| SMILES | C=CC[C@H]1CO[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C15H30O4Si/c1-7-8-11-10-18-12(9-16)14(13(11)17)19-20(5,6)15(2,3)4/h7,11-14,16-17H,1,8-10H2,2-6H3/t11-,12+,13+,14+/m0/s1 |
| InChIKey | NKHLHWUSNHVZIE-REWJHTLYSA-N |
| XLogP | 2.32 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|