C22H25NO10S — CID 101234128
[(2R,3R,4S,5R,6S)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-5-hydroxyoxan-2-yl]methyl acetate (PubChem CID 101234128) has the molecular formula C22H25NO10S and a molecular weight of 495.51 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-5-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-5-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101234128 |
| Molecular Formula | C22H25NO10S |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-ethylsulfanyl-5-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CCS[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@]1(O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H25NO10S/c1-5-34-21-22(29,23-19(27)14-8-6-7-9-15(14)20(23)28)18(32-13(4)26)17(31-12(3)25)16(33-21)10-30-11(2)24/h6-9,16-18,21,29H,5,10H2,1-4H3/t16-,17-,18+,21+,22-/m1/s1 |
| InChIKey | SPPYDIJDTDZOEV-XPMXXILHSA-N |
| XLogP | 0.88 |
| TPSA | 145.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|