C23H22O4 — CID 101234134
[(1S,2S)-1,2-dihydroxy-1,2-bis(4-methylphenyl)ethyl] benzoate (PubChem CID 101234134) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is [(1S,2S)-1,2-dihydroxy-1,2-bis(4-methylphenyl)ethyl] benzoate.
| Compound Name | [(1S,2S)-1,2-dihydroxy-1,2-bis(4-methylphenyl)ethyl] benzoate |
|---|---|
| PubChem CID | 101234134 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [(1S,2S)-1,2-dihydroxy-1,2-bis(4-methylphenyl)ethyl] benzoate |
| SMILES | Cc1ccc([C@H](O)[C@@](O)(OC(=O)c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H22O4/c1-16-8-12-18(13-9-16)21(24)23(26,20-14-10-17(2)11-15-20)27-22(25)19-6-4-3-5-7-19/h3-15,21,24,26H,1-2H3/t21-,23-/m0/s1 |
| InChIKey | FTVVSVZIYCENFI-GMAHTHKFSA-N |
| XLogP | 4.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|